C17H14Cl2N4O3S2 — CID 100524820
N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 100524820) has the molecular formula C17H14Cl2N4O3S2 and a molecular weight of 457.36 g/mol. Its IUPAC name is N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 100524820 |
| Molecular Formula | C17H14Cl2N4O3S2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(S(=O)(=O)NCc3ccc(Cl)cc3Cl)s2)c1 |
| InChI | InChI=1S/C17H14Cl2N4O3S2/c1-10-3-2-4-11(7-10)15(24)21-16-22-23-17(27-16)28(25,26)20-9-12-5-6-13(18)8-14(12)19/h2-8,20H,9H2,1H3,(H,21,22,24) |
| InChIKey | QXVBJWCQQIHNBL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|