C19H16N6O4S2 — CID 100510294
N-[5-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100510294) has the molecular formula C19H16N6O4S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[5-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100510294 |
| Molecular Formula | C19H16N6O4S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[5-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1cccc(-c2noc(CNS(=O)(=O)c3nnc(NC(=O)c4ccccc4)s3)n2)c1 |
| InChI | InChI=1S/C19H16N6O4S2/c1-12-6-5-9-14(10-12)16-21-15(29-25-16)11-20-31(27,28)19-24-23-18(30-19)22-17(26)13-7-3-2-4-8-13/h2-10,20H,11H2,1H3,(H,22,23,26) |
| InChIKey | PQABADXUXYRSIJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|