C24H26N6O4S2 — CID 100605674
N-[5-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 100605674) has the molecular formula C24H26N6O4S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is N-[5-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 100605674 |
| Molecular Formula | C24H26N6O4S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | N-[5-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(S(=O)(=O)N(C)Cc3nc(-c4ccc(C(C)(C)C)cc4)no3)s2)c1 |
| InChI | InChI=1S/C24H26N6O4S2/c1-15-7-6-8-17(13-15)21(31)26-22-27-28-23(35-22)36(32,33)30(5)14-19-25-20(29-34-19)16-9-11-18(12-10-16)24(2,3)4/h6-13H,14H2,1-5H3,(H,26,27,31) |
| InChIKey | XKUKHHWRJOCIAX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|