C17H12Cl2N6O4S3 — CID 100760227
2,4-dichloro-N-[5-[methyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100760227) has the molecular formula C17H12Cl2N6O4S3 and a molecular weight of 531.43 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[methyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[methyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100760227 |
| Molecular Formula | C17H12Cl2N6O4S3 |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 529.95 |
| IUPAC Name | 2,4-dichloro-N-[5-[methyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CN(Cc1nc(-c2cccs2)no1)S(=O)(=O)c1nnc(NC(=O)c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C17H12Cl2N6O4S3/c1-25(8-13-20-14(24-29-13)12-3-2-6-30-12)32(27,28)17-23-22-16(31-17)21-15(26)10-5-4-9(18)7-11(10)19/h2-7H,8H2,1H3,(H,21,22,26) |
| InChIKey | QRQAFFDZISLZCF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|