C15H18N6O4S3 — CID 100607019
N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 100607019) has the molecular formula C15H18N6O4S3 and a molecular weight of 442.55 g/mol. Its IUPAC name is N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100607019 |
| Molecular Formula | C15H18N6O4S3 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CCN(Cc1nc(-c2cccs2)no1)S(=O)(=O)c1nnc(NC(=O)C(C)C)s1 |
| InChI | InChI=1S/C15H18N6O4S3/c1-4-21(8-11-16-12(20-25-11)10-6-5-7-26-10)28(23,24)15-19-18-14(27-15)17-13(22)9(2)3/h5-7,9H,4,8H2,1-3H3,(H,17,18,22) |
| InChIKey | UWTBQSAIRBUSDL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|