C14H18N4O4S2 — CID 22517567
N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide (PubChem CID 22517567) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 22517567 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1nnc(NC(=O)c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C14H18N4O4S2/c1-4-18(5-2)24(20,21)14-17-16-13(23-14)15-12(19)10-6-8-11(22-3)9-7-10/h6-9H,4-5H2,1-3H3,(H,15,16,19) |
| InChIKey | HFVABPHJAIFMDQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|