C15H20N4O5S2 — CID 22517578
N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-(4-methoxyphenoxy)acetamide (PubChem CID 22517578) has the molecular formula C15H20N4O5S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 22517578 |
| Molecular Formula | C15H20N4O5S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-(4-methoxyphenoxy)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1nnc(NC(=O)COc2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C15H20N4O5S2/c1-4-19(5-2)26(21,22)15-18-17-14(25-15)16-13(20)10-24-12-8-6-11(23-3)7-9-12/h6-9H,4-5,10H2,1-3H3,(H,16,17,20) |
| InChIKey | YLRAIHVHGVFEJM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|