C18H17FN4O4S2 — CID 22518072
2-(4-fluorophenoxy)-N-[5-[methyl-(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 22518072) has the molecular formula C18H17FN4O4S2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[5-[methyl-(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[5-[methyl-(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 22518072 |
| Molecular Formula | C18H17FN4O4S2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[5-[methyl-(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1cccc(N(C)S(=O)(=O)c2nnc(NC(=O)COc3ccc(F)cc3)s2)c1 |
| InChI | InChI=1S/C18H17FN4O4S2/c1-12-4-3-5-14(10-12)23(2)29(25,26)18-22-21-17(28-18)20-16(24)11-27-15-8-6-13(19)7-9-15/h3-10H,11H2,1-2H3,(H,20,21,24) |
| InChIKey | NVXPOKWDWKHTNH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|