C18H15ClN6O4S3 — CID 100616679
2-chloro-N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100616679) has the molecular formula C18H15ClN6O4S3 and a molecular weight of 511.01 g/mol. Its IUPAC name is 2-chloro-N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100616679 |
| Molecular Formula | C18H15ClN6O4S3 |
| Molecular Weight | 511.01 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | 2-chloro-N-[5-[ethyl-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCN(Cc1nc(-c2cccs2)no1)S(=O)(=O)c1nnc(NC(=O)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C18H15ClN6O4S3/c1-2-25(10-14-20-15(24-29-14)13-8-5-9-30-13)32(27,28)18-23-22-17(31-18)21-16(26)11-6-3-4-7-12(11)19/h3-9H,2,10H2,1H3,(H,21,22,26) |
| InChIKey | CLQRFVSPZDESDX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.01 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|