C14H10ClN3O2S — CID 93173363
2-chloro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 93173363) has the molecular formula C14H10ClN3O2S and a molecular weight of 319.77 g/mol. Its IUPAC name is 2-chloro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | 2-chloro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 93173363 |
| Molecular Formula | C14H10ClN3O2S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-chloro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | O=C(NCc1nc(-c2cccs2)no1)c1ccccc1Cl |
| InChI | InChI=1S/C14H10ClN3O2S/c15-10-5-2-1-4-9(10)14(19)16-8-12-17-13(18-20-12)11-6-3-7-21-11/h1-7H,8H2,(H,16,19) |
| InChIKey | RCSTVZSQQQJOOL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |