C14H8F3N3O2S — CID 110293449
2,3,4-trifluoro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 110293449) has the molecular formula C14H8F3N3O2S and a molecular weight of 339.30 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110293449 |
| Molecular Formula | C14H8F3N3O2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2,3,4-trifluoro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | O=C(NCc1nc(-c2cccs2)no1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H8F3N3O2S/c15-8-4-3-7(11(16)12(8)17)14(21)18-6-10-19-13(20-22-10)9-2-1-5-23-9/h1-5H,6H2,(H,18,21) |
| InChIKey | DAQCQBPUYZYDGI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|