C18H18FN3O2S — CID 9144215
2-fluoro-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide (PubChem CID 9144215) has the molecular formula C18H18FN3O2S and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-fluoro-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide.
| Compound Name | 2-fluoro-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide |
|---|---|
| PubChem CID | 9144215 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-fluoro-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide |
| SMILES | O=C(NCCCCCc1nc(-c2cccs2)no1)c1ccccc1F |
| InChI | InChI=1S/C18H18FN3O2S/c19-14-8-4-3-7-13(14)18(23)20-11-5-1-2-10-16-21-17(22-24-16)15-9-6-12-25-15/h3-4,6-9,12H,1-2,5,10-11H2,(H,20,23) |
| InChIKey | DARJSLNNFBEAFF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|