C14H19N3O3S — CID 9144032
ethyl N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]carbamate (PubChem CID 9144032) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is ethyl N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]carbamate.
| Compound Name | ethyl N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]carbamate |
|---|---|
| PubChem CID | 9144032 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | ethyl N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]carbamate |
| SMILES | CCOC(=O)NCCCCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C14H19N3O3S/c1-2-19-14(18)15-9-5-3-4-8-12-16-13(17-20-12)11-7-6-10-21-11/h6-7,10H,2-5,8-9H2,1H3,(H,15,18) |
| InChIKey | YFLXVIQINITNAZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|