C22H22N4O2S2 — CID 24505031
2-methyl-4-phenyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 24505031) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-methyl-4-phenyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-methyl-4-phenyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24505031 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-methyl-4-phenyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)NCCCCCc2nc(-c3cccs3)no2)s1 |
| InChI | InChI=1S/C22H22N4O2S2/c1-15-24-19(16-9-4-2-5-10-16)20(30-15)22(27)23-13-7-3-6-12-18-25-21(26-28-18)17-11-8-14-29-17/h2,4-5,8-11,14H,3,6-7,12-13H2,1H3,(H,23,27) |
| InChIKey | PICPGUDGABTUNT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|