C17H17N3O2S — CID 110293651
N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-2-thiophen-2-ylacetamide (PubChem CID 110293651) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 110293651 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCCCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C17H17N3O2S/c21-15(12-14-8-5-11-23-14)18-10-4-9-16-19-17(20-22-16)13-6-2-1-3-7-13/h1-3,5-8,11H,4,9-10,12H2,(H,18,21) |
| InChIKey | IZSMNYKIQXBEIN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|