C14H18N4O2 — CID 110293678
1,1-dimethyl-3-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]urea (PubChem CID 110293678) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,1-dimethyl-3-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]urea.
| Compound Name | 1,1-dimethyl-3-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]urea |
|---|---|
| PubChem CID | 110293678 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,1-dimethyl-3-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]urea |
| SMILES | CN(C)C(=O)NCCCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C14H18N4O2/c1-18(2)14(19)15-10-6-9-12-16-13(17-20-12)11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3,(H,15,19) |
| InChIKey | IDOYHGMALPHYJX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|