C14H18N4O2 — CID 17275261
1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylurea (PubChem CID 17275261) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylurea.
| Compound Name | 1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylurea |
|---|---|
| PubChem CID | 17275261 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylurea |
| SMILES | CCCNC(=O)N(C)Cc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C14H18N4O2/c1-3-9-15-14(19)18(2)10-12-16-13(17-20-12)11-7-5-4-6-8-11/h4-8H,3,9-10H2,1-2H3,(H,15,19) |
| InChIKey | LYHBTAFCNIHQTO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |