C14H18N4OS — CID 17275437
1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylthiourea (PubChem CID 17275437) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylthiourea.
| Compound Name | 1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 17275437 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-methyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)N(C)Cc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-9-15-14(20)18(2)10-12-16-13(17-19-12)11-7-5-4-6-8-11/h4-8H,3,9-10H2,1-2H3,(H,15,20) |
| InChIKey | DRWLTYFRTFFQDX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|