C20H20N4O2S3 — CID 24517351
4-methyl-2-thiophen-2-yl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 24517351) has the molecular formula C20H20N4O2S3 and a molecular weight of 444.61 g/mol. Its IUPAC name is 4-methyl-2-thiophen-2-yl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-thiophen-2-yl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24517351 |
| Molecular Formula | C20H20N4O2S3 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 4-methyl-2-thiophen-2-yl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)NCCCCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C20H20N4O2S3/c1-13-17(29-20(22-13)15-8-6-12-28-15)19(25)21-10-4-2-3-9-16-23-18(24-26-16)14-7-5-11-27-14/h5-8,11-12H,2-4,9-10H2,1H3,(H,21,25) |
| InChIKey | QSVBRUAAFBMPLI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|