C21H22F3N3O3S — CID 24625234
N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 24625234) has the molecular formula C21H22F3N3O3S and a molecular weight of 453.49 g/mol. Its IUPAC name is N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 24625234 |
| Molecular Formula | C21H22F3N3O3S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | O=C(NCCCCCc1nc(-c2cccs2)no1)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3N3O3S/c22-21(23,24)14-29-13-15-7-9-16(10-8-15)20(28)25-11-3-1-2-6-18-26-19(27-30-18)17-5-4-12-31-17/h4-5,7-10,12H,1-3,6,11,13-14H2,(H,25,28) |
| InChIKey | CONVLKWZJBUZHG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|