C21H22N4O3S2 — CID 24550878
2-(1,3-benzothiazol-2-ylmethoxy)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]acetamide (PubChem CID 24550878) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 24550878 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]acetamide |
| SMILES | O=C(COCc1nc2ccccc2s1)NCCCCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C21H22N4O3S2/c26-18(13-27-14-20-23-15-7-3-4-8-16(15)30-20)22-11-5-1-2-10-19-24-21(25-28-19)17-9-6-12-29-17/h3-4,6-9,12H,1-2,5,10-11,13-14H2,(H,22,26) |
| InChIKey | MLUOZBFXXPKJRQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|