C19H21N3O3S — CID 18120241
N-(4-phenoxybutyl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 18120241) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-(4-phenoxybutyl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-(4-phenoxybutyl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 18120241 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(4-phenoxybutyl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | O=C(CCc1nc(-c2cccs2)no1)NCCCCOc1ccccc1 |
| InChI | InChI=1S/C19H21N3O3S/c23-17(20-12-4-5-13-24-15-7-2-1-3-8-15)10-11-18-21-19(22-25-18)16-9-6-14-26-16/h1-3,6-9,14H,4-5,10-13H2,(H,20,23) |
| InChIKey | FIUKCFKRFWOJSS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|