C22H23N5O3S — CID 24505024
3-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide (PubChem CID 24505024) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide.
| Compound Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide |
|---|---|
| PubChem CID | 24505024 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide |
| SMILES | O=C(CCc1nnc(-c2ccccc2)o1)NCCCCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C22H23N5O3S/c28-18(12-13-20-25-26-22(29-20)16-8-3-1-4-9-16)23-14-6-2-5-11-19-24-21(27-30-19)17-10-7-15-31-17/h1,3-4,7-10,15H,2,5-6,11-14H2,(H,23,28) |
| InChIKey | BUTFPYKVPXFQRS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|