C22H22N4O3S — CID 56544268
N-(3-quinolin-8-yloxypropyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 56544268) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(3-quinolin-8-yloxypropyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-(3-quinolin-8-yloxypropyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 56544268 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(3-quinolin-8-yloxypropyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | O=C(CCCc1nc(-c2cccs2)no1)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C22H22N4O3S/c27-19(10-2-11-20-25-22(26-29-20)18-9-4-15-30-18)23-13-5-14-28-17-8-1-6-16-7-3-12-24-21(16)17/h1,3-4,6-9,12,15H,2,5,10-11,13-14H2,(H,23,27) |
| InChIKey | YNIFXDMQXMFRBX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|