C14H17N3O4S2 — CID 119241569
2-[2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]ethylsulfanyl]acetic acid (PubChem CID 119241569) has the molecular formula C14H17N3O4S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241569 |
| Molecular Formula | C14H17N3O4S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-[2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)CCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C14H17N3O4S2/c18-11(15-6-8-22-9-13(19)20)4-1-5-12-16-14(17-21-12)10-3-2-7-23-10/h2-3,7H,1,4-6,8-9H2,(H,15,18)(H,19,20) |
| InChIKey | WBFRFEOPCQGZGD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|