C21H20N4O2S — CID 9144052
N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]quinoline-2-carboxamide (PubChem CID 9144052) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]quinoline-2-carboxamide.
| Compound Name | N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 9144052 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]quinoline-2-carboxamide |
| SMILES | O=C(NCCCCCc1nc(-c2cccs2)no1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H20N4O2S/c26-21(17-12-11-15-7-3-4-8-16(15)23-17)22-13-5-1-2-10-19-24-20(25-27-19)18-9-6-14-28-18/h3-4,6-9,11-12,14H,1-2,5,10,13H2,(H,22,26) |
| InChIKey | VICIEPPBMBEJJN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|