C19H18N4O2S — CID 9144170
3-cyano-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide (PubChem CID 9144170) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-cyano-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide.
| Compound Name | 3-cyano-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide |
|---|---|
| PubChem CID | 9144170 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-cyano-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCCCCCc2nc(-c3cccs3)no2)c1 |
| InChI | InChI=1S/C19H18N4O2S/c20-13-14-6-4-7-15(12-14)19(24)21-10-3-1-2-9-17-22-18(23-25-17)16-8-5-11-26-16/h4-8,11-12H,1-3,9-10H2,(H,21,24) |
| InChIKey | UIOBADHPDJPGLV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|