C15H10N4O2S — CID 51096359
4-cyano-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 51096359) has the molecular formula C15H10N4O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-cyano-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | 4-cyano-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 51096359 |
| Molecular Formula | C15H10N4O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4-cyano-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NCc2nc(-c3cccs3)no2)cc1 |
| InChI | InChI=1S/C15H10N4O2S/c16-8-10-3-5-11(6-4-10)15(20)17-9-13-18-14(19-21-13)12-2-1-7-22-12/h1-7H,9H2,(H,17,20) |
| InChIKey | CCWABWNAPMHOEL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |