C20H17ClN6O4S2 — CID 100691514
4-chloro-N-[5-[methyl-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100691514) has the molecular formula C20H17ClN6O4S2 and a molecular weight of 504.98 g/mol. Its IUPAC name is 4-chloro-N-[5-[methyl-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[methyl-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100691514 |
| Molecular Formula | C20H17ClN6O4S2 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 4-chloro-N-[5-[methyl-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1-c1noc(CN(C)S(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3)s2)n1 |
| InChI | InChI=1S/C20H17ClN6O4S2/c1-12-5-3-4-6-15(12)17-22-16(31-26-17)11-27(2)33(29,30)20-25-24-19(32-20)23-18(28)13-7-9-14(21)10-8-13/h3-10H,11H2,1-2H3,(H,23,24,28) |
| InChIKey | GIOZJFWGHZRXOY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|