C19H15ClN6O5S2 — CID 100687525
4-chloro-N-[5-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100687525) has the molecular formula C19H15ClN6O5S2 and a molecular weight of 506.95 g/mol. Its IUPAC name is 4-chloro-N-[5-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100687525 |
| Molecular Formula | C19H15ClN6O5S2 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | 4-chloro-N-[5-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(-c2noc(CNS(=O)(=O)c3nnc(NC(=O)c4ccc(Cl)cc4)s3)n2)cc1 |
| InChI | InChI=1S/C19H15ClN6O5S2/c1-30-14-8-4-11(5-9-14)16-22-15(31-26-16)10-21-33(28,29)19-25-24-18(32-19)23-17(27)12-2-6-13(20)7-3-12/h2-9,21H,10H2,1H3,(H,23,24,27) |
| InChIKey | GACPBPLSYIXEFM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|