C19H15N5O3S2 — CID 163212919
4-methoxy-N-[5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 163212919) has the molecular formula C19H15N5O3S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 4-methoxy-N-[5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 163212919 |
| Molecular Formula | C19H15N5O3S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-methoxy-N-[5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(SCc3nc(-c4ccccc4)no3)s2)cc1 |
| InChI | InChI=1S/C19H15N5O3S2/c1-26-14-9-7-13(8-10-14)17(25)21-18-22-23-19(29-18)28-11-15-20-16(24-27-15)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,21,22,25) |
| InChIKey | DIOXPVGCBBSSDN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|