C22H21N5O2S2 — CID 24622345
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 24622345) has the molecular formula C22H21N5O2S2 and a molecular weight of 451.58 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 24622345 |
| Molecular Formula | C22H21N5O2S2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCc1ccc(-c2noc(CCC(=O)Nc3nnc(SCc4ccccc4)s3)n2)cc1 |
| InChI | InChI=1S/C22H21N5O2S2/c1-2-15-8-10-17(11-9-15)20-24-19(29-27-20)13-12-18(28)23-21-25-26-22(31-21)30-14-16-6-4-3-5-7-16/h3-11H,2,12-14H2,1H3,(H,23,25,28) |
| InChIKey | QGPPYVAFVAHWRT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|