C15H14FN5O2S2 — CID 16566411
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 16566411) has the molecular formula C15H14FN5O2S2 and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 16566411 |
| Molecular Formula | C15H14FN5O2S2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCSc1nnc(NC(=O)CCc2nc(-c3ccc(F)cc3)no2)s1 |
| InChI | InChI=1S/C15H14FN5O2S2/c1-2-24-15-20-19-14(25-15)17-11(22)7-8-12-18-13(21-23-12)9-3-5-10(16)6-4-9/h3-6H,2,7-8H2,1H3,(H,17,19,22) |
| InChIKey | YUSPKQKANSCECK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|