C14H12ClN5O2S2 — CID 17344209
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 17344209) has the molecular formula C14H12ClN5O2S2 and a molecular weight of 381.87 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 17344209 |
| Molecular Formula | C14H12ClN5O2S2 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CSc1nnc(NC(=O)CCc2nc(-c3ccc(Cl)cc3)no2)s1 |
| InChI | InChI=1S/C14H12ClN5O2S2/c1-23-14-19-18-13(24-14)16-10(21)6-7-11-17-12(20-22-11)8-2-4-9(15)5-3-8/h2-5H,6-7H2,1H3,(H,16,18,21) |
| InChIKey | AYPYAVCZPZZBRU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|