C16H17N5O3S2 — CID 17344167
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 17344167) has the molecular formula C16H17N5O3S2 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 17344167 |
| Molecular Formula | C16H17N5O3S2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCSc1nnc(NC(=O)CCc2nc(-c3ccccc3OC)no2)s1 |
| InChI | InChI=1S/C16H17N5O3S2/c1-3-25-16-20-19-15(26-16)17-12(22)8-9-13-18-14(21-24-13)10-6-4-5-7-11(10)23-2/h4-7H,3,8-9H2,1-2H3,(H,17,19,22) |
| InChIKey | LRBSYEONLNNHSK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|