C22H20N4O2S2 — CID 24593000
3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 24593000) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 24593000 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCSc1nnc(NC(=O)CCc2nc(-c3ccccc3)c(-c3ccccc3)o2)s1 |
| InChI | InChI=1S/C22H20N4O2S2/c1-2-29-22-26-25-21(30-22)23-17(27)13-14-18-24-19(15-9-5-3-6-10-15)20(28-18)16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3,(H,23,25,27) |
| InChIKey | BPBMIFNECACALJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|