C21H18N6O3S2 — CID 17354737
N-[5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 17354737) has the molecular formula C21H18N6O3S2 and a molecular weight of 466.55 g/mol. Its IUPAC name is N-[5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-[5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 17354737 |
| Molecular Formula | C21H18N6O3S2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | Cc1ccc(C(=O)CSc2nnc(NC(=O)CCc3nc(-c4ccccn4)no3)s2)cc1 |
| InChI | InChI=1S/C21H18N6O3S2/c1-13-5-7-14(8-6-13)16(28)12-31-21-26-25-20(32-21)23-17(29)9-10-18-24-19(27-30-18)15-4-2-3-11-22-15/h2-8,11H,9-10,12H2,1H3,(H,23,25,29) |
| InChIKey | YFMMBVAUMGWGJU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|