C20H22N4O5S2 — CID 20921620
N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 20921620) has the molecular formula C20H22N4O5S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 20921620 |
| Molecular Formula | C20H22N4O5S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | COc1ccc(CN(C)S(=O)(=O)c2nnc(NC(=O)c3cccc(C)c3)s2)cc1OC |
| InChI | InChI=1S/C20H22N4O5S2/c1-13-6-5-7-15(10-13)18(25)21-19-22-23-20(30-19)31(26,27)24(2)12-14-8-9-16(28-3)17(11-14)29-4/h5-11H,12H2,1-4H3,(H,21,22,25) |
| InChIKey | JWHFIBSTOAAAMV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|