C17H24N4O5S2 — CID 20921626
N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 20921626) has the molecular formula C17H24N4O5S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 20921626 |
| Molecular Formula | C17H24N4O5S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[5-[(3,4-dimethoxyphenyl)methyl-methylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(CN(C)S(=O)(=O)c2nnc(NC(=O)C(C)(C)C)s2)cc1OC |
| InChI | InChI=1S/C17H24N4O5S2/c1-17(2,3)14(22)18-15-19-20-16(27-15)28(23,24)21(4)10-11-7-8-12(25-5)13(9-11)26-6/h7-9H,10H2,1-6H3,(H,18,19,22) |
| InChIKey | MJRATHGSTNUGAZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|