C10H8ClN3O3S2 — CID 17012997
3-chloro-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 17012997) has the molecular formula C10H8ClN3O3S2 and a molecular weight of 317.78 g/mol. Its IUPAC name is 3-chloro-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-chloro-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 17012997 |
| Molecular Formula | C10H8ClN3O3S2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 3-chloro-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CS(=O)(=O)c1nnc(NC(=O)c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C10H8ClN3O3S2/c1-19(16,17)10-14-13-9(18-10)12-8(15)6-3-2-4-7(11)5-6/h2-5H,1H3,(H,12,13,15) |
| InChIKey | ZODNMEIHFXIMFM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|