C13H12ClN3O2S — CID 51721207
3-chloro-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 51721207) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is 3-chloro-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-chloro-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 51721207 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-chloro-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc([C@@H]2CCCO2)s1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H12ClN3O2S/c14-9-4-1-3-8(7-9)11(18)15-13-17-16-12(20-13)10-5-2-6-19-10/h1,3-4,7,10H,2,5-6H2,(H,15,17,18)/t10-/m0/s1 |
| InChIKey | XGFTZZKDSBBWTC-JTQLQIEISA-N |
| XLogP | 3.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |