C13H13ClN4O2S — CID 19187582
1-(3-chlorophenyl)-3-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 19187582) has the molecular formula C13H13ClN4O2S and a molecular weight of 324.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 19187582 |
| Molecular Formula | C13H13ClN4O2S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nnc(C2CCCO2)s1 |
| InChI | InChI=1S/C13H13ClN4O2S/c14-8-3-1-4-9(7-8)15-12(19)16-13-18-17-11(21-13)10-5-2-6-20-10/h1,3-4,7,10H,2,5-6H2,(H2,15,16,18,19) |
| InChIKey | GGVVBNFTSJEJHQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |