C14H14N4O4S — CID 19182046
4-methyl-3-nitro-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 19182046) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 19182046 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-methyl-3-nitro-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(C3CCCO3)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N4O4S/c1-8-4-5-9(7-10(8)18(20)21)12(19)15-14-17-16-13(23-14)11-3-2-6-22-11/h4-5,7,11H,2-3,6H2,1H3,(H,15,17,19) |
| InChIKey | JMRQWJNXTVJAOS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|