C13H12ClN3OS2 — CID 42805599
3-chloro-N-[5-(cyclopropylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 42805599) has the molecular formula C13H12ClN3OS2 and a molecular weight of 325.85 g/mol. Its IUPAC name is 3-chloro-N-[5-(cyclopropylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-chloro-N-[5-(cyclopropylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42805599 |
| Molecular Formula | C13H12ClN3OS2 |
| Molecular Weight | 325.85 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 3-chloro-N-[5-(cyclopropylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(SCC2CC2)s1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H12ClN3OS2/c14-10-3-1-2-9(6-10)11(18)15-12-16-17-13(20-12)19-7-8-4-5-8/h1-3,6,8H,4-5,7H2,(H,15,16,18) |
| InChIKey | WFPAXRFQLVNVDN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|