C16H20Cl2N4OS2 — CID 171668668
3-chloro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride (PubChem CID 171668668) has the molecular formula C16H20Cl2N4OS2 and a molecular weight of 419.40 g/mol. Its IUPAC name is 3-chloro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride.
| Compound Name | 3-chloro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 171668668 |
| Molecular Formula | C16H20Cl2N4OS2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 3-chloro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(SCCN2CCCCC2)s1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H19ClN4OS2.ClH/c17-13-6-4-5-12(11-13)14(22)18-15-19-20-16(24-15)23-10-9-21-7-2-1-3-8-21;/h4-6,11H,1-3,7-10H2,(H,18,19,22);1H |
| InChIKey | MNRZHGTXSUPEHP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|