C16H19ClF2N4OS2 — CID 171700169
2,4-difluoro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride (PubChem CID 171700169) has the molecular formula C16H19ClF2N4OS2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 2,4-difluoro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride.
| Compound Name | 2,4-difluoro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 171700169 |
| Molecular Formula | C16H19ClF2N4OS2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2,4-difluoro-N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(SCCN2CCCCC2)s1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H18F2N4OS2.ClH/c17-11-4-5-12(13(18)10-11)14(23)19-15-20-21-16(25-15)24-9-8-22-6-2-1-3-7-22;/h4-5,10H,1-3,6-9H2,(H,19,20,23);1H |
| InChIKey | GSJPXOOLONFUSD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|