C15H15F2N3OS2 — CID 42805536
N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentanecarboxamide (PubChem CID 42805536) has the molecular formula C15H15F2N3OS2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentanecarboxamide.
| Compound Name | N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42805536 |
| Molecular Formula | C15H15F2N3OS2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(F)cc2F)s1)C1CCCC1 |
| InChI | InChI=1S/C15H15F2N3OS2/c16-11-6-5-10(12(17)7-11)8-22-15-20-19-14(23-15)18-13(21)9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H,18,19,21) |
| InChIKey | XIUYOTMYLDTNQA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|