C18H14F2N4O2S3 — CID 146086493
1-(2,4-difluorophenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 146086493) has the molecular formula C18H14F2N4O2S3 and a molecular weight of 452.53 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 146086493 |
| Molecular Formula | C18H14F2N4O2S3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 1-(2,4-difluorophenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccs2)s1)C1CC(=O)N(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H14F2N4O2S3/c19-11-3-4-14(13(20)7-11)24-8-10(6-15(24)25)16(26)21-17-22-23-18(29-17)28-9-12-2-1-5-27-12/h1-5,7,10H,6,8-9H2,(H,21,22,26) |
| InChIKey | MJJUFBJGAMETQF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|