C15H15FN4O3S2 — CID 7483866
(3S)-1-(4-fluorophenyl)-N-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 7483866) has the molecular formula C15H15FN4O3S2 and a molecular weight of 382.44 g/mol. Its IUPAC name is (3S)-1-(4-fluorophenyl)-N-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-fluorophenyl)-N-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7483866 |
| Molecular Formula | C15H15FN4O3S2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | (3S)-1-(4-fluorophenyl)-N-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCCO)s1)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H15FN4O3S2/c16-10-1-3-11(4-2-10)20-8-9(7-12(20)22)13(23)17-14-18-19-15(25-14)24-6-5-21/h1-4,9,21H,5-8H2,(H,17,18,23)/t9-/m0/s1 |
| InChIKey | RECVMONPJVRWRM-VIFPVBQESA-N |
| XLogP | 1.75 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|