C18H22N4O3S2 — CID 17082422
1-(3,4-dimethylphenyl)-N-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 17082422) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)-N-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17082422 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COCCSc1nnc(NC(=O)C2CC(=O)N(c3ccc(C)c(C)c3)C2)s1 |
| InChI | InChI=1S/C18H22N4O3S2/c1-11-4-5-14(8-12(11)2)22-10-13(9-15(22)23)16(24)19-17-20-21-18(27-17)26-7-6-25-3/h4-5,8,13H,6-7,9-10H2,1-3H3,(H,19,20,24) |
| InChIKey | GCFUDERCXXNIEP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|